C14H20N2O3S — CID 51161787
N,N-diethyl-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 51161787) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N,N-diethyl-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N,N-diethyl-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 51161787 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N,N-diethyl-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C14H20N2O3S/c1-4-10-15-20(18,19)13-9-7-8-12(11-13)14(17)16(5-2)6-3/h4,7-9,11,15H,1,5-6,10H2,2-3H3 |
| InChIKey | KAEKJLAQZRXHBG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|