C15H20N2O5S — CID 119191062
3-[ethyl-[3-(prop-2-enylsulfamoyl)benzoyl]amino]propanoic acid (PubChem CID 119191062) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[ethyl-[3-(prop-2-enylsulfamoyl)benzoyl]amino]propanoic acid.
| Compound Name | 3-[ethyl-[3-(prop-2-enylsulfamoyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119191062 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-[ethyl-[3-(prop-2-enylsulfamoyl)benzoyl]amino]propanoic acid |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N(CC)CCC(=O)O)c1 |
| InChI | InChI=1S/C15H20N2O5S/c1-3-9-16-23(21,22)13-7-5-6-12(11-13)15(20)17(4-2)10-8-14(18)19/h3,5-7,11,16H,1,4,8-10H2,2H3,(H,18,19) |
| InChIKey | ZMWVSFPKDJOZRM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|