C20H23ClN4O — CID 18288172
N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-1H-indazole-3-carboxamide (PubChem CID 18288172) has the molecular formula C20H23ClN4O and a molecular weight of 370.88 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 18288172 |
| Molecular Formula | C20H23ClN4O |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-(diethylamino)ethyl]-1H-indazole-3-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1n[nH]c2ccccc12)c1ccccc1Cl |
| InChI | InChI=1S/C20H23ClN4O/c1-3-25(4-2)18(14-9-5-7-11-16(14)21)13-22-20(26)19-15-10-6-8-12-17(15)23-24-19/h5-12,18H,3-4,13H2,1-2H3,(H,22,26)(H,23,24) |
| InChIKey | QBMKUXFROKJDFY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |