C20H32ClN3O3 — CID 43044946
tert-butyl N-[3-[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-3-oxopropyl]carbamate (PubChem CID 43044946) has the molecular formula C20H32ClN3O3 and a molecular weight of 397.95 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 43044946 |
| Molecular Formula | C20H32ClN3O3 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | tert-butyl N-[3-[[2-(2-chlorophenyl)-2-(diethylamino)ethyl]amino]-3-oxopropyl]carbamate |
| SMILES | CCN(CC)C(CNC(=O)CCNC(=O)OC(C)(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C20H32ClN3O3/c1-6-24(7-2)17(15-10-8-9-11-16(15)21)14-23-18(25)12-13-22-19(26)27-20(3,4)5/h8-11,17H,6-7,12-14H2,1-5H3,(H,22,26)(H,23,25) |
| InChIKey | CMTNSGLCGANIKS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |