C14H19ClN2O3 — CID 111451181
N-[2-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-2-oxoethyl]butanamide (PubChem CID 111451181) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is N-[2-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-2-oxoethyl]butanamide.
| Compound Name | N-[2-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 111451181 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-[2-[[2-(2-chlorophenyl)-2-hydroxyethyl]amino]-2-oxoethyl]butanamide |
| SMILES | CCCC(=O)NCC(=O)NCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C14H19ClN2O3/c1-2-5-13(19)17-9-14(20)16-8-12(18)10-6-3-4-7-11(10)15/h3-4,6-7,12,18H,2,5,8-9H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | LCGAJBUWWPCJGT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |