C15H20Cl2N2O3 — CID 71874340
N'-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-N-propylbutanediamide (PubChem CID 71874340) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is N'-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-N-propylbutanediamide.
| Compound Name | N'-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-N-propylbutanediamide |
|---|---|
| PubChem CID | 71874340 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N'-[2-(2,6-dichlorophenyl)-2-hydroxyethyl]-N-propylbutanediamide |
| SMILES | CCCNC(=O)CCC(=O)NCC(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-2-8-18-13(21)6-7-14(22)19-9-12(20)15-10(16)4-3-5-11(15)17/h3-5,12,20H,2,6-9H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | MCBJTHXZIQZKEY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |