C12H14Cl2N2O2 — CID 57192756
2-[(2,6-dichlorophenyl)methylideneamino]oxy-N-propylacetamide (PubChem CID 57192756) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylideneamino]oxy-N-propylacetamide.
| Compound Name | 2-[(2,6-dichlorophenyl)methylideneamino]oxy-N-propylacetamide |
|---|---|
| PubChem CID | 57192756 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylideneamino]oxy-N-propylacetamide |
| SMILES | CCCNC(=O)CON=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-2-6-15-12(17)8-18-16-7-9-10(13)4-3-5-11(9)14/h3-5,7H,2,6,8H2,1H3,(H,15,17) |
| InChIKey | BWWINAFLDWIQQP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|