C11H10Cl2N2O5 — CID 173431791
[2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate (PubChem CID 173431791) has the molecular formula C11H10Cl2N2O5 and a molecular weight of 321.12 g/mol. Its IUPAC name is [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate.
| Compound Name | [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate |
|---|---|
| PubChem CID | 173431791 |
| Molecular Formula | C11H10Cl2N2O5 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate |
| SMILES | NOCC(=O)OC(=O)CON=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O5/c12-8-2-1-3-9(13)7(8)4-15-19-6-11(17)20-10(16)5-18-14/h1-4H,5-6,14H2 |
| InChIKey | OVVHJSJIJDRXCV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|