About [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate
[2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate (PubChem CID 173431791) has the molecular formula C11H10Cl2N2O5
and a molecular weight of 321.12 g/mol. Its IUPAC name is [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate.
Molecular Properties
| Compound Name | [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate |
| PubChem CID | 173431791 |
| Molecular Formula | C11H10Cl2N2O5 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate |
| SMILES | NOCC(=O)OC(=O)CON=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O5/c12-8-2-1-3-9(13)7(8)4-15-19-6-11(17)20-10(16)5-18-14/h1-4H,5-6,14H2 |
| InChIKey | OVVHJSJIJDRXCV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate?
The IUPAC name of [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate (CID 173431791) is [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate.
What is the SMILES notation for [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate?
The canonical SMILES for [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate is NOCC(=O)OC(=O)CON=Cc1c(Cl)cccc1Cl.
What is the InChIKey of [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate?
The InChIKey is OVVHJSJIJDRXCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2N2O5/c12-8-2-1-3-9(13)7(8)4-15-19-6-11(17)20-10(16)5-18-14/h1-4H,5-6,14H2.
What are the key properties of [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate?
[2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate has a molecular weight of 321.12 g/mol, XLogP of 1.30, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,6-dichlorophenyl)methylideneamino]oxyacetyl] 2-aminooxyacetate is sourced from PubChem (CID 173431791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).