C11H11Cl2NO3 — CID 173365405
ethyl 2-[(E)-(2,4-dichlorophenyl)methylideneamino]oxyacetate (PubChem CID 173365405) has the molecular formula C11H11Cl2NO3 and a molecular weight of 276.12 g/mol. Its IUPAC name is ethyl 2-[(E)-(2,4-dichlorophenyl)methylideneamino]oxyacetate.
| Compound Name | ethyl 2-[(E)-(2,4-dichlorophenyl)methylideneamino]oxyacetate |
|---|---|
| PubChem CID | 173365405 |
| Molecular Formula | C11H11Cl2NO3 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | ethyl 2-[(E)-(2,4-dichlorophenyl)methylideneamino]oxyacetate |
| SMILES | CCOC(=O)CO/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO3/c1-2-16-11(15)7-17-14-6-8-3-4-9(12)5-10(8)13/h3-6H,2,7H2,1H3/b14-6+ |
| InChIKey | VHCPEEQOEIIZSZ-MKMNVTDBSA-N |
| XLogP | 2.91 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|