C10H9Cl2NO — CID 173365422
(E)-1-(2,4-dichlorophenyl)-N-prop-2-enoxymethanimine (PubChem CID 173365422) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)-N-prop-2-enoxymethanimine.
| Compound Name | (E)-1-(2,4-dichlorophenyl)-N-prop-2-enoxymethanimine |
|---|---|
| PubChem CID | 173365422 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)-N-prop-2-enoxymethanimine |
| SMILES | C=CCO/N=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2NO/c1-2-5-14-13-7-8-3-4-9(11)6-10(8)12/h2-4,6-7H,1,5H2/b13-7+ |
| InChIKey | KCNDNZGLWDOQHV-NTUHNPAUSA-N |
| XLogP | 3.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|