C8H8Cl2N2 — CID 67650124
N-[(2,4-dichlorophenyl)methylideneamino]methanamine (PubChem CID 67650124) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]methanamine.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]methanamine |
|---|---|
| PubChem CID | 67650124 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]methanamine |
| SMILES | CNN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2N2/c1-11-12-5-6-2-3-7(9)4-8(6)10/h2-5,11H,1H3 |
| InChIKey | PPACPVDJESNEEG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|