C15H12Cl5N5 — CID 140813801
1,2-bis[(2,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 140813801) has the molecular formula C15H12Cl5N5 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1,2-bis[(2,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(2,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 140813801 |
| Molecular Formula | C15H12Cl5N5 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 436.95 |
| IUPAC Name | 1,2-bis[(2,4-dichlorophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.N/C(=N/N=Cc1ccc(Cl)cc1Cl)NN=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl4N5.ClH/c16-11-3-1-9(13(18)5-11)7-21-23-15(20)24-22-8-10-2-4-12(17)6-14(10)19;/h1-8H,(H3,20,23,24);1H |
| InChIKey | BPFOWMKIWJERRU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|