C19H19Cl2N7O2 — CID 154403714
N-[2-[[[N'-[(2-acetamido-4-chlorophenyl)methylideneamino]carbamimidoyl]hydrazinylidene]methyl]-5-chlorophenyl]acetamide (PubChem CID 154403714) has the molecular formula C19H19Cl2N7O2 and a molecular weight of 448.31 g/mol. Its IUPAC name is N-[2-[[[N'-[(2-acetamido-4-chlorophenyl)methylideneamino]carbamimidoyl]hydrazinylidene]methyl]-5-chlorophenyl]acetamide.
| Compound Name | N-[2-[[[N'-[(2-acetamido-4-chlorophenyl)methylideneamino]carbamimidoyl]hydrazinylidene]methyl]-5-chlorophenyl]acetamide |
|---|---|
| PubChem CID | 154403714 |
| Molecular Formula | C19H19Cl2N7O2 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[2-[[[N'-[(2-acetamido-4-chlorophenyl)methylideneamino]carbamimidoyl]hydrazinylidene]methyl]-5-chlorophenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Cl)ccc1C=NN=C(N)NN=Cc1ccc(Cl)cc1NC(C)=O |
| InChI | InChI=1S/C19H19Cl2N7O2/c1-11(29)25-17-7-15(20)5-3-13(17)9-23-27-19(22)28-24-10-14-4-6-16(21)8-18(14)26-12(2)30/h3-10H,1-2H3,(H,25,29)(H,26,30)(H3,22,27,28) |
| InChIKey | HLYWKWKMPXMFJC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 133.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|