C15H16Cl3N7 — CID 131746622
1,2-bis[(2-amino-4-chlorophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 131746622) has the molecular formula C15H16Cl3N7 and a molecular weight of 400.70 g/mol. Its IUPAC name is 1,2-bis[(2-amino-4-chlorophenyl)methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(2-amino-4-chlorophenyl)methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 131746622 |
| Molecular Formula | C15H16Cl3N7 |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 1,2-bis[(2-amino-4-chlorophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NC(=NN=Cc1ccc(Cl)cc1N)NN=Cc1ccc(Cl)cc1N |
| InChI | InChI=1S/C15H15Cl2N7.ClH/c16-11-3-1-9(13(18)5-11)7-21-23-15(20)24-22-8-10-2-4-12(17)6-14(10)19;/h1-8H,18-19H2,(H3,20,23,24);1H |
| InChIKey | YFDQGZWFSNLXDR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|