C15H15Cl2N7 — CID 86279330
1,2-bis[(E)-(2-amino-4-chlorophenyl)methylideneamino]guanidine (PubChem CID 86279330) has the molecular formula C15H15Cl2N7 and a molecular weight of 364.24 g/mol. Its IUPAC name is 1,2-bis[(E)-(2-amino-4-chlorophenyl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(E)-(2-amino-4-chlorophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 86279330 |
| Molecular Formula | C15H15Cl2N7 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1,2-bis[(E)-(2-amino-4-chlorophenyl)methylideneamino]guanidine |
| SMILES | N/C(=N\N=C\c1ccc(Cl)cc1N)N/N=C/c1ccc(Cl)cc1N |
| InChI | InChI=1S/C15H15Cl2N7/c16-11-3-1-9(13(18)5-11)7-21-23-15(20)24-22-8-10-2-4-12(17)6-14(10)19/h1-8H,18-19H2,(H3,20,23,24)/b21-7+,22-8+ |
| InChIKey | BSVRDKHTVQQSMF-KVJLFNRQSA-N |
| XLogP | 2.43 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|