C15H15N5O4 — CID 172918115
1,2-bis[(E)-(2,3-dihydroxyphenyl)methylideneamino]guanidine (PubChem CID 172918115) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is 1,2-bis[(E)-(2,3-dihydroxyphenyl)methylideneamino]guanidine.
| Compound Name | 1,2-bis[(E)-(2,3-dihydroxyphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 172918115 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1,2-bis[(E)-(2,3-dihydroxyphenyl)methylideneamino]guanidine |
| SMILES | NC(=N/N=C/c1cccc(O)c1O)N/N=C/c1cccc(O)c1O |
| InChI | InChI=1S/C15H15N5O4/c16-15(19-17-7-9-3-1-5-11(21)13(9)23)20-18-8-10-4-2-6-12(22)14(10)24/h1-8,21-24H,(H3,16,19,20)/b17-7+,18-8+ |
| InChIKey | IXYPIWUHECMNCC-ZEELXFFVSA-N |
| XLogP | 0.78 |
| TPSA | 156.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|