C10H13N3O2S — CID 135925130
3-[(2,3-dihydroxyphenyl)methylideneamino]-1,1-dimethylthiourea (PubChem CID 135925130) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-[(2,3-dihydroxyphenyl)methylideneamino]-1,1-dimethylthiourea.
| Compound Name | 3-[(2,3-dihydroxyphenyl)methylideneamino]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 135925130 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-[(2,3-dihydroxyphenyl)methylideneamino]-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NN=Cc1cccc(O)c1O |
| InChI | InChI=1S/C10H13N3O2S/c1-13(2)10(16)12-11-6-7-4-3-5-8(14)9(7)15/h3-6,14-15H,1-2H3,(H,12,16) |
| InChIKey | FIHJGOBGVSIMQK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|