C10H13N3S — CID 13297422
3-[(E)-benzylideneamino]-1,1-dimethylthiourea (PubChem CID 13297422) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 3-[(E)-benzylideneamino]-1,1-dimethylthiourea.
| Compound Name | 3-[(E)-benzylideneamino]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 13297422 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-[(E)-benzylideneamino]-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)N/N=C/c1ccccc1 |
| InChI | InChI=1S/C10H13N3S/c1-13(2)10(14)12-11-8-9-6-4-3-5-7-9/h3-8H,1-2H3,(H,12,14)/b11-8+ |
| InChIKey | HUIHABALNVOXJQ-DHZHZOJOSA-N |
| XLogP | 1.46 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|