C13H13FN4S — CID 162669012
3-[(4-fluoroisoquinolin-1-yl)methylideneamino]-1,1-dimethylthiourea (PubChem CID 162669012) has the molecular formula C13H13FN4S and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[(4-fluoroisoquinolin-1-yl)methylideneamino]-1,1-dimethylthiourea.
| Compound Name | 3-[(4-fluoroisoquinolin-1-yl)methylideneamino]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 162669012 |
| Molecular Formula | C13H13FN4S |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 3-[(4-fluoroisoquinolin-1-yl)methylideneamino]-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)NN=Cc1ncc(F)c2ccccc12 |
| InChI | InChI=1S/C13H13FN4S/c1-18(2)13(19)17-16-8-12-10-6-4-3-5-9(10)11(14)7-15-12/h3-8H,1-2H3,(H,17,19) |
| InChIKey | ANCYIJDBQRHAHB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|