C14H20N6S2 — CID 6399992
3-[(E)-[(2E)-2-(dimethylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]-1,1-dimethylthiourea (PubChem CID 6399992) has the molecular formula C14H20N6S2 and a molecular weight of 336.49 g/mol. Its IUPAC name is 3-[(E)-[(2E)-2-(dimethylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]-1,1-dimethylthiourea.
| Compound Name | 3-[(E)-[(2E)-2-(dimethylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]-1,1-dimethylthiourea |
|---|---|
| PubChem CID | 6399992 |
| Molecular Formula | C14H20N6S2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-[(E)-[(2E)-2-(dimethylcarbamothioylhydrazinylidene)-1-phenylethylidene]amino]-1,1-dimethylthiourea |
| SMILES | CN(C)C(=S)N/N=C/C(=N/NC(=S)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H20N6S2/c1-19(2)13(21)17-15-10-12(11-8-6-5-7-9-11)16-18-14(22)20(3)4/h5-10H,1-4H3,(H,17,21)(H,18,22)/b15-10+,16-12- |
| InChIKey | LKFNJXLIFHTTQD-HDVIWIBHSA-N |
| XLogP | 1.25 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|