C13H17N5OS2 — CID 146412293
O-ethyl N-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-2-phenylethylidene]amino]carbamothioate (PubChem CID 146412293) has the molecular formula C13H17N5OS2 and a molecular weight of 323.45 g/mol. Its IUPAC name is O-ethyl N-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-2-phenylethylidene]amino]carbamothioate.
| Compound Name | O-ethyl N-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-2-phenylethylidene]amino]carbamothioate |
|---|---|
| PubChem CID | 146412293 |
| Molecular Formula | C13H17N5OS2 |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | O-ethyl N-[(E)-[(2E)-2-(methylcarbamothioylhydrazinylidene)-2-phenylethylidene]amino]carbamothioate |
| SMILES | CCOC(=S)N/N=C/C(=N/NC(=S)NC)c1ccccc1 |
| InChI | InChI=1S/C13H17N5OS2/c1-3-19-13(21)18-15-9-11(16-17-12(20)14-2)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,18,21)(H2,14,17,20)/b15-9+,16-11- |
| InChIKey | SLGYNPOYUFCTSJ-VGJYFWKZSA-N |
| XLogP | 1.38 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|