C15H18N6O2S2 — CID 162740797
1-[(Z)-[(2Z)-1-(7-methoxy-1-benzofuran-2-yl)-2-(methylcarbamothioylhydrazinylidene)ethylidene]amino]-3-methylthiourea (PubChem CID 162740797) has the molecular formula C15H18N6O2S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 1-[(Z)-[(2Z)-1-(7-methoxy-1-benzofuran-2-yl)-2-(methylcarbamothioylhydrazinylidene)ethylidene]amino]-3-methylthiourea.
| Compound Name | 1-[(Z)-[(2Z)-1-(7-methoxy-1-benzofuran-2-yl)-2-(methylcarbamothioylhydrazinylidene)ethylidene]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 162740797 |
| Molecular Formula | C15H18N6O2S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[(Z)-[(2Z)-1-(7-methoxy-1-benzofuran-2-yl)-2-(methylcarbamothioylhydrazinylidene)ethylidene]amino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C\C(=N\NC(=S)NC)c1cc2cccc(OC)c2o1 |
| InChI | InChI=1S/C15H18N6O2S2/c1-16-14(24)20-18-8-10(19-21-15(25)17-2)12-7-9-5-4-6-11(22-3)13(9)23-12/h4-8H,1-3H3,(H2,16,20,24)(H2,17,21,25)/b18-8-,19-10- |
| InChIKey | PWQRSTNODIJJSO-IECKAUOHSA-N |
| XLogP | 1.32 |
| TPSA | 95.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|