C13H15N3O4S — CID 21235892
8-methoxy-2-oxochromene-3-carboxamide;methylthiourea (PubChem CID 21235892) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 8-methoxy-2-oxochromene-3-carboxamide;methylthiourea.
| Compound Name | 8-methoxy-2-oxochromene-3-carboxamide;methylthiourea |
|---|---|
| PubChem CID | 21235892 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 8-methoxy-2-oxochromene-3-carboxamide;methylthiourea |
| SMILES | CNC(N)=S.COc1cccc2cc(C(N)=O)c(=O)oc12 |
| InChI | InChI=1S/C11H9NO4.C2H6N2S/c1-15-8-4-2-3-6-5-7(10(12)13)11(14)16-9(6)8;1-4-2(3)5/h2-5H,1H3,(H2,12,13);1H3,(H3,3,4,5) |
| InChIKey | YJRZOVCHSLSIIE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 120.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|