C18H21NO4 — CID 3137792
3-(2,6-dimethylpiperidine-1-carbonyl)-8-methoxychromen-2-one (PubChem CID 3137792) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperidine-1-carbonyl)-8-methoxychromen-2-one.
| Compound Name | 3-(2,6-dimethylpiperidine-1-carbonyl)-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 3137792 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-(2,6-dimethylpiperidine-1-carbonyl)-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3C(C)CCCC3C)c(=O)oc12 |
| InChI | InChI=1S/C18H21NO4/c1-11-6-4-7-12(2)19(11)17(20)14-10-13-8-5-9-15(22-3)16(13)23-18(14)21/h5,8-12H,4,6-7H2,1-3H3 |
| InChIKey | KHHMKTHXMMEWHB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|