C16H15NO6S — CID 122273296
3-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptane-5-carbonyl)-8-methoxychromen-2-one (PubChem CID 122273296) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is 3-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptane-5-carbonyl)-8-methoxychromen-2-one.
| Compound Name | 3-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptane-5-carbonyl)-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 122273296 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 3-(2,2-dioxo-2λ6-thia-5-azabicyclo[2.2.1]heptane-5-carbonyl)-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CC4CC3CS4(=O)=O)c(=O)oc12 |
| InChI | InChI=1S/C16H15NO6S/c1-22-13-4-2-3-9-5-12(16(19)23-14(9)13)15(18)17-7-11-6-10(17)8-24(11,20)21/h2-5,10-11H,6-8H2,1H3 |
| InChIKey | CGKKMRUVGQCABT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|