C16H14N4O4 — CID 121154869
8-methoxy-3-[3-(triazol-1-yl)azetidine-1-carbonyl]chromen-2-one (PubChem CID 121154869) has the molecular formula C16H14N4O4 and a molecular weight of 326.31 g/mol. Its IUPAC name is 8-methoxy-3-[3-(triazol-1-yl)azetidine-1-carbonyl]chromen-2-one.
| Compound Name | 8-methoxy-3-[3-(triazol-1-yl)azetidine-1-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 121154869 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 8-methoxy-3-[3-(triazol-1-yl)azetidine-1-carbonyl]chromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CC(n4ccnn4)C3)c(=O)oc12 |
| InChI | InChI=1S/C16H14N4O4/c1-23-13-4-2-3-10-7-12(16(22)24-14(10)13)15(21)19-8-11(9-19)20-6-5-17-18-20/h2-7,11H,8-9H2,1H3 |
| InChIKey | KUYBMWXVAAFMHN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 90.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|