C18H21NO4 — CID 6471057
3-(azocane-1-carbonyl)-8-methoxychromen-2-one (PubChem CID 6471057) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-(azocane-1-carbonyl)-8-methoxychromen-2-one.
| Compound Name | 3-(azocane-1-carbonyl)-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 6471057 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-(azocane-1-carbonyl)-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CCCCCCC3)c(=O)oc12 |
| InChI | InChI=1S/C18H21NO4/c1-22-15-9-7-8-13-12-14(18(21)23-16(13)15)17(20)19-10-5-3-2-4-6-11-19/h7-9,12H,2-6,10-11H2,1H3 |
| InChIKey | BSWQMGDPUPLXET-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|