About 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one
3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one (PubChem CID 1070822) has the molecular formula C18H21NO4
and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one.
Molecular Properties
| Compound Name | 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one |
| PubChem CID | 1070822 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3[C@H](C)CCC[C@H]3C)c(=O)oc12 |
| InChI | InChI=1S/C18H21NO4/c1-11-6-4-7-12(2)19(11)17(20)14-10-13-8-5-9-15(22-3)16(13)23-18(14)21/h5,8-12H,4,6-7H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | KHHMKTHXMMEWHB-VXGBXAGGSA-N |
| XLogP | 3.20 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one?
The IUPAC name of 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one (CID 1070822) is 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one.
What is the SMILES notation for 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one?
The canonical SMILES for 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one is COc1cccc2cc(C(=O)N3[C@H](C)CCC[C@H]3C)c(=O)oc12.
What is the InChIKey of 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one?
The InChIKey is KHHMKTHXMMEWHB-VXGBXAGGSA-N. The full InChI is InChI=1S/C18H21NO4/c1-11-6-4-7-12(2)19(11)17(20)14-10-13-8-5-9-15(22-3)16(13)23-18(14)21/h5,8-12H,4,6-7H2,1-3H3/t11-,12-/m1/s1.
What are the key properties of 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one?
3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one has a molecular weight of 315.37 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,6R)-2,6-dimethylpiperidine-1-carbonyl]-8-methoxychromen-2-one is sourced from PubChem (CID 1070822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).