C20H20N4O4 — CID 121178275
8-methoxy-3-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane-8-carbonyl]chromen-2-one (PubChem CID 121178275) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 8-methoxy-3-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane-8-carbonyl]chromen-2-one.
| Compound Name | 8-methoxy-3-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane-8-carbonyl]chromen-2-one |
|---|---|
| PubChem CID | 121178275 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 8-methoxy-3-[3-(triazol-2-yl)-8-azabicyclo[3.2.1]octane-8-carbonyl]chromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3C4CCC3CC(n3nccn3)C4)c(=O)oc12 |
| InChI | InChI=1S/C20H20N4O4/c1-27-17-4-2-3-12-9-16(20(26)28-18(12)17)19(25)23-13-5-6-14(23)11-15(10-13)24-21-7-8-22-24/h2-4,7-9,13-15H,5-6,10-11H2,1H3 |
| InChIKey | JGZIUEABBDMHMN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 90.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|