C25H30N2O4 — CID 3238543
3-[4-(1-adamantyl)piperazine-1-carbonyl]-8-methoxychromen-2-one (PubChem CID 3238543) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-[4-(1-adamantyl)piperazine-1-carbonyl]-8-methoxychromen-2-one.
| Compound Name | 3-[4-(1-adamantyl)piperazine-1-carbonyl]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 3238543 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 3-[4-(1-adamantyl)piperazine-1-carbonyl]-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CCN(C45CC6CC(CC(C6)C4)C5)CC3)c(=O)oc12 |
| InChI | InChI=1S/C25H30N2O4/c1-30-21-4-2-3-19-12-20(24(29)31-22(19)21)23(28)26-5-7-27(8-6-26)25-13-16-9-17(14-25)11-18(10-16)15-25/h2-4,12,16-18H,5-11,13-15H2,1H3 |
| InChIKey | JZDRUCGULJGQAD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|