C22H21NO4S — CID 72720367
8-methoxy-3-(7-phenyl-1,4-thiazepane-4-carbonyl)chromen-2-one (PubChem CID 72720367) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is 8-methoxy-3-(7-phenyl-1,4-thiazepane-4-carbonyl)chromen-2-one.
| Compound Name | 8-methoxy-3-(7-phenyl-1,4-thiazepane-4-carbonyl)chromen-2-one |
|---|---|
| PubChem CID | 72720367 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 8-methoxy-3-(7-phenyl-1,4-thiazepane-4-carbonyl)chromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CCSC(c4ccccc4)CC3)c(=O)oc12 |
| InChI | InChI=1S/C22H21NO4S/c1-26-18-9-5-8-16-14-17(22(25)27-20(16)18)21(24)23-11-10-19(28-13-12-23)15-6-3-2-4-7-15/h2-9,14,19H,10-13H2,1H3 |
| InChIKey | QPFGNUIJAMVVQN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|