C20H15N3O5 — CID 122252443
2-[1-(8-methoxy-2-oxochromene-3-carbonyl)azetidin-3-yl]oxypyridine-4-carbonitrile (PubChem CID 122252443) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 2-[1-(8-methoxy-2-oxochromene-3-carbonyl)azetidin-3-yl]oxypyridine-4-carbonitrile.
| Compound Name | 2-[1-(8-methoxy-2-oxochromene-3-carbonyl)azetidin-3-yl]oxypyridine-4-carbonitrile |
|---|---|
| PubChem CID | 122252443 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[1-(8-methoxy-2-oxochromene-3-carbonyl)azetidin-3-yl]oxypyridine-4-carbonitrile |
| SMILES | COc1cccc2cc(C(=O)N3CC(Oc4cc(C#N)ccn4)C3)c(=O)oc12 |
| InChI | InChI=1S/C20H15N3O5/c1-26-16-4-2-3-13-8-15(20(25)28-18(13)16)19(24)23-10-14(11-23)27-17-7-12(9-21)5-6-22-17/h2-8,14H,10-11H2,1H3 |
| InChIKey | FPUJUQSGEAVIDL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|