C21H21N3O5 — CID 121017574
3-[3-(4,6-dimethylpyrimidin-2-yl)oxypyrrolidine-1-carbonyl]-8-methoxychromen-2-one (PubChem CID 121017574) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 3-[3-(4,6-dimethylpyrimidin-2-yl)oxypyrrolidine-1-carbonyl]-8-methoxychromen-2-one.
| Compound Name | 3-[3-(4,6-dimethylpyrimidin-2-yl)oxypyrrolidine-1-carbonyl]-8-methoxychromen-2-one |
|---|---|
| PubChem CID | 121017574 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-[3-(4,6-dimethylpyrimidin-2-yl)oxypyrrolidine-1-carbonyl]-8-methoxychromen-2-one |
| SMILES | COc1cccc2cc(C(=O)N3CCC(Oc4nc(C)cc(C)n4)C3)c(=O)oc12 |
| InChI | InChI=1S/C21H21N3O5/c1-12-9-13(2)23-21(22-12)28-15-7-8-24(11-15)19(25)16-10-14-5-4-6-17(27-3)18(14)29-20(16)26/h4-6,9-10,15H,7-8,11H2,1-3H3 |
| InChIKey | LKOZZZRIDNSKND-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|