C14H13NO6 — CID 10493768
(2S)-2-[(8-methoxy-2-oxochromene-3-carbonyl)amino]propanoic acid (PubChem CID 10493768) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is (2S)-2-[(8-methoxy-2-oxochromene-3-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(8-methoxy-2-oxochromene-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 10493768 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (2S)-2-[(8-methoxy-2-oxochromene-3-carbonyl)amino]propanoic acid |
| SMILES | COc1cccc2cc(C(=O)N[C@@H](C)C(=O)O)c(=O)oc12 |
| InChI | InChI=1S/C14H13NO6/c1-7(13(17)18)15-12(16)9-6-8-4-3-5-10(20-2)11(8)21-14(9)19/h3-7H,1-2H3,(H,15,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | YYMDWOGLVDNGES-ZETCQYMHSA-N |
| XLogP | 1.00 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|