C18H13NO7 — CID 66485426
2-hydroxy-3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]benzoic acid (PubChem CID 66485426) has the molecular formula C18H13NO7 and a molecular weight of 355.30 g/mol. Its IUPAC name is 2-hydroxy-3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-hydroxy-3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 66485426 |
| Molecular Formula | C18H13NO7 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 2-hydroxy-3-[(8-methoxy-2-oxochromene-3-carbonyl)amino]benzoic acid |
| SMILES | COc1cccc2cc(C(=O)Nc3cccc(C(=O)O)c3O)c(=O)oc12 |
| InChI | InChI=1S/C18H13NO7/c1-25-13-7-2-4-9-8-11(18(24)26-15(9)13)16(21)19-12-6-3-5-10(14(12)20)17(22)23/h2-8,20H,1H3,(H,19,21)(H,22,23) |
| InChIKey | UPFAZTUSJJAOLF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|