C17H12BrNO5 — CID 1288481
6-bromo-N-(2-hydroxyphenyl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 1288481) has the molecular formula C17H12BrNO5 and a molecular weight of 390.19 g/mol. Its IUPAC name is 6-bromo-N-(2-hydroxyphenyl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | 6-bromo-N-(2-hydroxyphenyl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 1288481 |
| Molecular Formula | C17H12BrNO5 |
| Molecular Weight | 390.19 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 6-bromo-N-(2-hydroxyphenyl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cc(Br)cc2cc(C(=O)Nc3ccccc3O)c(=O)oc12 |
| InChI | InChI=1S/C17H12BrNO5/c1-23-14-8-10(18)6-9-7-11(17(22)24-15(9)14)16(21)19-12-4-2-3-5-13(12)20/h2-8,20H,1H3,(H,19,21) |
| InChIKey | PGJKJDMVDNFSBL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|