C18H12N2O4 — CID 17087466
N-(2-cyanophenyl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 17087466) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is N-(2-cyanophenyl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2-cyanophenyl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 17087466 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(2-cyanophenyl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccccc3C#N)c(=O)oc12 |
| InChI | InChI=1S/C18H12N2O4/c1-23-15-8-4-6-11-9-13(18(22)24-16(11)15)17(21)20-14-7-3-2-5-12(14)10-19/h2-9H,1H3,(H,20,21) |
| InChIKey | KVHKGMQSIJORJV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|