C20H20N3O5+ — CID 7224115
8-methoxy-N-(2-morpholin-4-ylpyridin-1-ium-3-yl)-2-oxochromene-3-carboxamide (PubChem CID 7224115) has the molecular formula C20H20N3O5+ and a molecular weight of 382.40 g/mol. Its IUPAC name is 8-methoxy-N-(2-morpholin-4-ylpyridin-1-ium-3-yl)-2-oxochromene-3-carboxamide.
| Compound Name | 8-methoxy-N-(2-morpholin-4-ylpyridin-1-ium-3-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 7224115 |
| Molecular Formula | C20H20N3O5+ |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 8-methoxy-N-(2-morpholin-4-ylpyridin-1-ium-3-yl)-2-oxochromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccc[nH+]c3N3CCOCC3)c(=O)oc12 |
| InChI | InChI=1S/C20H19N3O5/c1-26-16-6-2-4-13-12-14(20(25)28-17(13)16)19(24)22-15-5-3-7-21-18(15)23-8-10-27-11-9-23/h2-7,12H,8-11H2,1H3,(H,22,24)/p+1 |
| InChIKey | YMRBDYWGMMRECM-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|