C25H28N2O7 — CID 4614512
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-8-methoxy-2-oxochromene-3-carboxamide (PubChem CID 4614512) has the molecular formula C25H28N2O7 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-8-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-8-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4614512 |
| Molecular Formula | C25H28N2O7 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-8-methoxy-2-oxochromene-3-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1cc2cccc(OC)c2oc1=O |
| InChI | InChI=1S/C25H28N2O7/c1-4-32-21-15-19(27-9-11-31-12-10-27)22(33-5-2)14-18(21)26-24(28)17-13-16-7-6-8-20(30-3)23(16)34-25(17)29/h6-8,13-15H,4-5,9-12H2,1-3H3,(H,26,28) |
| InChIKey | SRFMVPCRWFTBSE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 99.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|