C28H31FN2O5 — CID 5126230
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide (PubChem CID 5126230) has the molecular formula C28H31FN2O5 and a molecular weight of 494.56 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 5126230 |
| Molecular Formula | C28H31FN2O5 |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-[(4-fluorophenyl)methoxy]benzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1ccccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H31FN2O5/c1-3-34-26-18-24(31-13-15-33-16-14-31)27(35-4-2)17-23(26)30-28(32)22-7-5-6-8-25(22)36-19-20-9-11-21(29)12-10-20/h5-12,17-18H,3-4,13-16,19H2,1-2H3,(H,30,32) |
| InChIKey | ARYAUUDZBMYDSB-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|