C22H26F2N2O5 — CID 22830164
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(difluoromethoxy)benzamide (PubChem CID 22830164) has the molecular formula C22H26F2N2O5 and a molecular weight of 436.46 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(difluoromethoxy)benzamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 22830164 |
| Molecular Formula | C22H26F2N2O5 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(difluoromethoxy)benzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C22H26F2N2O5/c1-3-29-19-14-18(26-8-10-28-11-9-26)20(30-4-2)13-17(19)25-21(27)15-6-5-7-16(12-15)31-22(23)24/h5-7,12-14,22H,3-4,8-11H2,1-2H3,(H,25,27) |
| InChIKey | YETXMYOWIJJSSQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|