C27H33N5O4 — CID 108792595
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide (PubChem CID 108792595) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 108792595 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1cccc(Nc2nc(C)cc(C)n2)c1 |
| InChI | InChI=1S/C27H33N5O4/c1-5-35-24-17-23(32-10-12-34-13-11-32)25(36-6-2)16-22(24)31-26(33)20-8-7-9-21(15-20)30-27-28-18(3)14-19(4)29-27/h7-9,14-17H,5-6,10-13H2,1-4H3,(H,31,33)(H,28,29,30) |
| InChIKey | PZGCVMLAQIBSEF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|