C21H24Cl2N2O4 — CID 4853152
3,4-dichloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzamide (PubChem CID 4853152) has the molecular formula C21H24Cl2N2O4 and a molecular weight of 439.34 g/mol. Its IUPAC name is 3,4-dichloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzamide.
| Compound Name | 3,4-dichloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 4853152 |
| Molecular Formula | C21H24Cl2N2O4 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 3,4-dichloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)benzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N2O4/c1-3-28-19-13-18(25-7-9-27-10-8-25)20(29-4-2)12-17(19)24-21(26)14-5-6-15(22)16(23)11-14/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,24,26) |
| InChIKey | NKAJAIWVQREDMO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|