C25H30ClN3O5 — CID 26701955
4-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 26701955) has the molecular formula C25H30ClN3O5 and a molecular weight of 487.98 g/mol. Its IUPAC name is 4-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | 4-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 26701955 |
| Molecular Formula | C25H30ClN3O5 |
| Molecular Weight | 487.98 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-chloro-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1ccc(Cl)c(N2CCCC2=O)c1 |
| InChI | InChI=1S/C25H30ClN3O5/c1-3-33-22-16-21(28-10-12-32-13-11-28)23(34-4-2)15-19(22)27-25(31)17-7-8-18(26)20(14-17)29-9-5-6-24(29)30/h7-8,14-16H,3-6,9-13H2,1-2H3,(H,27,31) |
| InChIKey | KRXVFUCAJTYRDC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.98 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|