C23H30N2O5 — CID 26690586
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-methoxy-4-methylbenzamide (PubChem CID 26690586) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-methoxy-4-methylbenzamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-methoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 26690586 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-3-methoxy-4-methylbenzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C23H30N2O5/c1-5-29-21-15-19(25-9-11-28-12-10-25)22(30-6-2)14-18(21)24-23(26)17-8-7-16(3)20(13-17)27-4/h7-8,13-15H,5-6,9-12H2,1-4H3,(H,24,26) |
| InChIKey | CBALKVIXFVJGRC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|