C21H25FN2O4 — CID 2439401
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluorobenzamide (PubChem CID 2439401) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluorobenzamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 2439401 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-2-fluorobenzamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C21H25FN2O4/c1-3-27-19-14-18(24-9-11-26-12-10-24)20(28-4-2)13-17(19)23-21(25)15-7-5-6-8-16(15)22/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,23,25) |
| InChIKey | UQFTXODXFOUAPM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|