C25H30FN3O5 — CID 41030803
(3R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 41030803) has the molecular formula C25H30FN3O5 and a molecular weight of 471.53 g/mol. Its IUPAC name is (3R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 41030803 |
| Molecular Formula | C25H30FN3O5 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (3R)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-1-(2-fluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)[C@@H]1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C25H30FN3O5/c1-3-33-22-15-21(28-9-11-32-12-10-28)23(34-4-2)14-19(22)27-25(31)17-13-24(30)29(16-17)20-8-6-5-7-18(20)26/h5-8,14-15,17H,3-4,9-13,16H2,1-2H3,(H,27,31)/t17-/m1/s1 |
| InChIKey | WDYFXRDLHKTIPV-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|