C21H22F2N2O4 — CID 46404018
N-(2,5-diethoxyphenyl)-1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 46404018) has the molecular formula C21H22F2N2O4 and a molecular weight of 404.41 g/mol. Its IUPAC name is N-(2,5-diethoxyphenyl)-1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2,5-diethoxyphenyl)-1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46404018 |
| Molecular Formula | C21H22F2N2O4 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-(2,5-diethoxyphenyl)-1-(2,4-difluorophenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)C2CC(=O)N(c3ccc(F)cc3F)C2)c1 |
| InChI | InChI=1S/C21H22F2N2O4/c1-3-28-15-6-8-19(29-4-2)17(11-15)24-21(27)13-9-20(26)25(12-13)18-7-5-14(22)10-16(18)23/h5-8,10-11,13H,3-4,9,12H2,1-2H3,(H,24,27) |
| InChIKey | POINCJRMBIJFIW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |