C17H18F2N2O3 — CID 46859658
1-(2,5-diethoxyphenyl)-3-(2,4-difluorophenyl)urea (PubChem CID 46859658) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-(2,5-diethoxyphenyl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(2,5-diethoxyphenyl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 46859658 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-(2,5-diethoxyphenyl)-3-(2,4-difluorophenyl)urea |
| SMILES | CCOc1ccc(OCC)c(NC(=O)Nc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H18F2N2O3/c1-3-23-12-6-8-16(24-4-2)15(10-12)21-17(22)20-14-7-5-11(18)9-13(14)19/h5-10H,3-4H2,1-2H3,(H2,20,21,22) |
| InChIKey | JZLWHDJWHLRWTG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |