C19H22F2N2O3 — CID 2554098
1-(2,4-difluorophenyl)-3-(3,4-dipropoxyphenyl)urea (PubChem CID 2554098) has the molecular formula C19H22F2N2O3 and a molecular weight of 364.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(3,4-dipropoxyphenyl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(3,4-dipropoxyphenyl)urea |
|---|---|
| PubChem CID | 2554098 |
| Molecular Formula | C19H22F2N2O3 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3,4-dipropoxyphenyl)urea |
| SMILES | CCCOc1ccc(NC(=O)Nc2ccc(F)cc2F)cc1OCCC |
| InChI | InChI=1S/C19H22F2N2O3/c1-3-9-25-17-8-6-14(12-18(17)26-10-4-2)22-19(24)23-16-7-5-13(20)11-15(16)21/h5-8,11-12H,3-4,9-10H2,1-2H3,(H2,22,23,24) |
| InChIKey | DJCBQQINKLWNJY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |